| Name |
Vaticanol C Vaticanol C isomer |
| Formula |
C56H42O12 |
| Mw |
906.26762681 |
| CAS RN |
287101-84-2 |
| C_ID |
C00037981
, 
|
| InChIKey |
IASMCVJKSVRCAS-JDZUPQEBNA-N |
| InChICode |
InChI=1S/C56H42O12/c57-31-9-1-25(2-10-31)43-47-39-23-41(66)56-53(46(30-19-37(63)22-38(64)20-30)55(68-56)28-7-15-34(60)16-8-28)48(39)51(43)44(26-3-11-32(58)12-4-26)49-40(65)24-42-50(52(47)49)45(29-17-35(61)21-36(62)18-29)54(67-42)27-5-13-33(59)14-6-27/h1-24,43-47,51,54-55,57-66H/t43-,44+,45-,46+,47?,51?,54-,55+/m0/s1 |
| SMILES |
Oc1ccc(C2Oc3c(O)cc4c(c3[C@H]2c2cc(O)cc(O)c2)[C@@H]2C(c3ccc(O)cc3)[C@@H]4c3c(c(O)cc4c3[C@@H](c3cc(O)cc(O)c3)[C@H](c3ccc(O)cc3)O4)[C@H]2c2ccc(O)cc2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dipterocarpaceae | Vatica rassak | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis vinifera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|