| Name |
Vaccaxanthone |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
125850-40-0 |
| C_ID |
C00037979
, 
|
| InChIKey |
XXSWIKUEZGNXHS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-22-6-3-8(17)11-9(4-6)24-15-10(23-2)5-7(16(20)21)13(18)12(15)14(11)19/h3-5,17-18H,1-2H3,(H,20,21) |
| SMILES |
COc1cc(O)c2c(=O)c3c(O)c(C(=O)O)cc(OC)c3oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Saponaria vaccaria  | Ref. |
| Plantae | Caryophyllaceae | Vaccaria segetalis  | Ref. |
|
|
zoom in
| Organism | Vaccaria segetalis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|