| Name |
Sylvatine |
| Formula |
C24H33NO3 |
| Mw |
383.24604393 |
| CAS RN |
42438-80-2 |
| C_ID |
C00037873
, 
|
| InChIKey |
URFYPQQKBYOWIX-UDNGMWKQSA-N |
| InChICode |
InChI=1S/C24H33NO3/c1-20(2)12-8-6-4-3-5-7-11-17-25-24(26)14-10-9-13-21-15-16-22-23(18-21)28-19-27-22/h3-4,9-10,13-16,18,20H,5-8,11-12,17,19H2,1-2H3,(H,25,26)/b4-3+,13-9+,14-10+ |
| SMILES |
CC(C)CCC/C=C/CCCCNC(=O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Piperaceae | Piper guineense Schum.et Thom.  | Ref. |
| Plantae | Piperaceae | Piper longum  | Ref. |
| Plantae | Piperaceae | Piper retrofractum Vahl.  | Ref. |
| Plantae | Piperaceae | Piper sylvaticum Roxb.  | Ref. |
|
|
zoom in
| Organism | Piper longum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|