| Name |
Sapxanthone (+)-Sapxanthone |
| Formula |
C30H38O9 |
| Mw |
542.25158281 |
| CAS RN |
126622-58-0 |
| C_ID |
C00037791
, 
|
| InChIKey |
XHMQNLOGSICKAT-ZHACJKMWNA-N |
| InChICode |
InChI=1S/C30H38O9/c1-4-5-7-12-20(31)13-8-6-9-14-25(33)38-15-10-11-19-16-24(37-3)30-27(28(19)34)29(35)26-22(32)17-21(36-2)18-23(26)39-30/h10-11,16-18,20,31-32,34H,4-9,12-15H2,1-3H3/b11-10+/t20-/m1/s1 |
| SMILES |
CCCCCC(O)CCCCCC(=O)OC/C=C/c1cc(OC)c2oc3cc(OC)cc(O)c3c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Saponaria vaccaria  | Ref. |
| Plantae | Caryophyllaceae | Vaccaria segetalis  | Ref. |
|
|
zoom in
| Organism | Vaccaria segetalis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|