| Name |
N-Acetyl-N-debenzoyltaxol |
| Formula |
C42H49NO14 |
| Mw |
791.31530528 |
| CAS RN |
173101-48-9 |
| C_ID |
C00037537
, 
|
| InChIKey |
NANZRVGWMMGVIQ-OVIBAZMJNA-N |
| InChICode |
InChI=1S/C42H49NO14/c1-21-27(55-38(51)32(48)31(43-22(2)44)25-14-10-8-11-15-25)19-42(52)36(56-37(50)26-16-12-9-13-17-26)34-40(7,28(47)18-29-41(34,20-53-29)57-24(4)46)35(49)33(54-23(3)45)30(21)39(42,5)6/h8-17,27-29,31-34,36,47-48,52H,18-20H2,1-7H3,(H,43,44)/t27-,28+,29-,31+,32-,33-,34+,36+,40-,41+,42-/m1/s1 |
| SMILES |
CC(=O)N[C@@H](c1ccccc1)[C@@H](O)C(=O)OC1C[C@@]2(O)[C@@H](OC(=O)c3ccccc3)C3[C@](C)(C(=O)[C@H](OC(C)=O)C(=C1C)C2(C)C)[C@@H](O)C[C@H]1OC[C@@]31OC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp L-His |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Taxaceae | Taxus canadensis | Ref. |
| Plantae | Taxaceae | Taxus media | Ref. |
|
|
zoom in
| Organism | Taxus media | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|