| Name |
Epivogeloside |
| Formula |
C17H24O10 |
| Mw |
388.13694699 |
| CAS RN |
118627-52-4 |
| C_ID |
C00037112
, 
|
| InChIKey |
RAYZRCGMIDUTKS-KSLXKWJYNA-N |
| InChICode |
InChI=1S/C17H24O10/c1-3-7-8-4-11(23-2)26-15(22)9(8)6-24-16(7)27-17-14(21)13(20)12(19)10(5-18)25-17/h3,6-8,10-14,16-21H,1,4-5H2,2H3/t7-,8-,10+,11-,12+,13-,14+,16-,17-/m0/s1 |
| SMILES |
C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C2C(=O)O[C@H](OC)C[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica Thunb.  | Ref. |
| Plantae | Rubiaceae | Mitragyna inermis  | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
|
|
zoom in
| Organism | Mitragyna inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|