| Name |
Buergeriside B2 |
| Formula |
C18H22O8 |
| Mw |
366.13146768 |
| CAS RN |
296251-44-0 |
| C_ID |
C00036845
, 
|
| InChIKey |
IYUGFXZFXCANKO-AJARFFBLNA-N |
| InChICode |
InChI=1S/C18H22O8/c1-10-15(21)16(17(18(22)24-10)25-11(2)19)26-14(20)9-6-12-4-7-13(23-3)8-5-12/h4-10,15-18,21-22H,1-3H3/b9-6-/t10-,15-,16+,17+,18+/m0/s1 |
| SMILES |
COc1ccc(/C=CC(=O)O[C@@H]2[C@@H](O)[C@H](C)O[C@@H](O)[C@@H]2OC(C)=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia buergeriana MIQ | Ref. |
| Plantae | Scrophulariaceae | Scrophularia huergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia huergeriana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|