| Name |
Buergeriside A1 |
| Formula |
C28H30O10 |
| Mw |
526.18389718 |
| CAS RN |
296759-85-8 |
| C_ID |
C00036843
, 
|
| InChIKey |
ODLWVJASYLYINB-PXOPOAERNA-N |
| InChICode |
InChI=1S/C28H30O10/c1-17-25(37-23(30)15-9-19-5-11-21(33-3)12-6-19)26(27(28(32)35-17)36-18(2)29)38-24(31)16-10-20-7-13-22(34-4)14-8-20/h5-17,25-28,32H,1-4H3/b15-9+,16-10+/t17-,25-,26-,27+,28+/m0/s1 |
| SMILES |
COc1ccc(/C=C/C(=O)OC2[C@@H](OC(=O)/C=C/c3ccc(OC)cc3)[C@H](C)O[C@@H](O)[C@@H]2OC(C)=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia buergeriana MIQ | Ref. |
| Plantae | Scrophulariaceae | Scrophularia huergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia huergeriana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|