| Name |
alpha-Amyrin acetate |
| Formula |
C32H52O2 |
| Mw |
468.3967309 |
| CAS RN |
863-76-3 |
| C_ID |
C00036709
, 
|
| InChIKey |
UDXDFWBZZQHDRO-AGWOVUQBNA-N |
| InChICode |
InChI=1S/C32H52O2/c1-20-12-15-29(6)18-19-31(8)23(27(29)21(20)2)10-11-25-30(7)16-14-26(34-22(3)33)28(4,5)24(30)13-17-32(25,31)9/h10,20-21,24-27H,11-19H2,1-9H3/t20-,21+,24+,25-,26+,27+,29-,30+,31-,32-/m1/s1 |
| SMILES |
CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Marsdenia sinensis | Ref. |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Asteraceae | Artemisia vulgaris  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia milli | Ref. |
| Plantae | Malvaceae | Eriolaena hookeriana | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus cathayana | Ref. |
|
|
zoom in
| Organism | Nerium oleander | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|