| Name |
Aragoside (-)-Aragoside |
| Formula |
C34H44O20 |
| Mw |
772.24259385 |
| CAS RN |
625855-85-8 |
| C_ID |
C00036040
, 
|
| InChIKey |
KXPJSAHXIDCYOG-XYTAKHJXNA-N |
| InChICode |
InChI=1S/C34H44O20/c35-11-21-25(44)26(45)28(47)33(50-21)53-30-29(52-23(42)6-3-14-1-4-16(37)18(39)9-14)22(12-36)51-34(48-8-7-15-2-5-17(38)19(40)10-15)31(30)54-32-27(46)24(43)20(41)13-49-32/h1-6,9-10,20-22,24-41,43-47H,7-8,11-13H2/b6-3+/t20-,21+,22+,24-,25-,26-,27+,28+,29+,30-,31+,32-,33-,34+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@@H]2OC[C@H](O)[C@H](O)[C@H]2O)[C@H](OCCc2ccc(O)c(O)c2)O[C@@H]1CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Aragoa cundinamarcensis | Ref. |
| Plantae | Plantaginaceae | Veronica lavaudiana | Ref. |
|
|
zoom in
| Organism | Veronica lavaudiana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|