| Name |
7-Methoxy-beta-Carboline 1-propionic acid
7-Methoxy-beta-carboline-1-propionic acid |
| Formula |
C15H14N2O3 |
| Mw |
270.10044233 |
| CAS RN |
137756-13-9 |
| C_ID |
C00035975
, 
|
| InChIKey |
WEBVBZDGWMAXEF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H14N2O3/c1-20-9-2-3-10-11-6-7-16-12(4-5-14(18)19)15(11)17-13(10)8-9/h2-3,6-8,17H,4-5H2,1H3,(H,18,19) |
| SMILES |
COc1ccc2c(c1)[nH]c1c(CCC(=O)O)nccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Simaroubaceae | Eurycoma harmandiana  | Ref. |
| Plantae | Simaroubaceae | Eurycoma longifolia | Ref. |
| Plantae | Simaroubaceae | Eurycoma longifolida | Ref. |
|
|
zoom in
| Organism | Eurycoma longifolia |
|---|
| Reference | Guo, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 16, (2005), 88.
Kuo, et al., Journal of Natural Products, 66, (2003), 1324.
Kanchanapoom, et al., Phytochemistry, 56, (2001), 383
Bedir,Chem.Pharm.Bull.,51,(2003),1301 |
|---|
|
