| Name |
3-O-beta-D-Quinovopyranosyl quinovic acid Quinovic acid 3-O-beta-D-quinovopyranoside |
| Formula |
C36H56O9 |
| Mw |
632.39243339 |
| CAS RN |
107870-05-3 |
| C_ID |
C00035937
, 
|
| InChIKey |
PUOQHFWXBKTHST-UNSIDATINA-N |
| InChICode |
InChI=1S/C36H56O9/c1-18-10-15-35(30(40)41)16-17-36(31(42)43)21(25(35)19(18)2)8-9-23-33(6)13-12-24(32(4,5)22(33)11-14-34(23,36)7)45-29-28(39)27(38)26(37)20(3)44-29/h8,18-20,22-29,37-39H,9-17H2,1-7H3,(H,40,41)(H,42,43)/t18-,19+,20-,22+,23-,24+,25+,26-,27+,28-,29+,33+,34-,35+,36-/m1/s1 |
| SMILES |
C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C(=O)O)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](C)[C@@H](O)[C@H](O)[C@H]6O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Mitragyna inermis  | Ref. |
| Plantae | Rubiaceae | Mitragyna rotundifolia | Ref. |
| Plantae | Rubiaceae | Neonauclea sessilifolia  | Ref. |
|
|
zoom in
| Organism | Mitragyna rotundifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|