| Name |
Tropic acid |
| Formula |
C9H10O3 |
| Mw |
166.06299419 |
| CAS RN |
552-63-6 |
| C_ID |
C00035885
, 
|
| InChIKey |
JACRWUWPXAESPB-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m0/s1 |
| SMILES |
O=C(O)C(CO)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum australe | Ref. |
| Plantae | Solanaceae | Datura stamonium | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
|
|
zoom in
| Organism | Datura stamonium |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
