| Name |
Gentiotrifloroside (-)-Gentiotrifloroside |
| Formula |
C29H36O17 |
| Mw |
656.19524973 |
| CAS RN |
873079-01-7 |
| C_ID |
C00035829
, 
|
| InChIKey |
XYZDSXRSOLCDDD-JDNSVYGQNA-N |
| InChICode |
InChI=1S/C29H36O17/c1-2-11-12-6-7-40-25(38)14(12)10-41-27(11)46-29-24(22(36)20(34)17(9-31)44-29)45-26(39)13-4-3-5-15(18(13)32)42-28-23(37)21(35)19(33)16(8-30)43-28/h2-5,10-12,16-17,19-24,27-37H,1,6-9H2/t11-,12-,16+,17+,19+,20+,21-,22-,23+,24+,27-,28-,29-/m0/s1 |
| SMILES |
C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2OC(=O)c2cccc(OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2O)OC=C2C(=O)OCC[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gentianaceae | Gentiana scabra  | Ref. |
| Plantae | Gentianaceae | Gentiana triflora | Ref. |
|
|
zoom in
| Organism | Gentiana triflora | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|