| Name |
1,3-Dimethylbenzene m-Xylene |
| Formula |
C8H10 |
| Mw |
106.07825032 |
| CAS RN |
108-38-3 |
| C_ID |
C00035778
, 
|
| InChIKey |
IVSZLXZYQVIEFR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3 |
| SMILES |
Cc1cccc(C)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum Mill.  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Petroselinum crispum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|