| Name |
Purpureaside B |
| Formula |
C35H46O20 |
| Mw |
786.25824391 |
| CAS RN |
104777-69-7 |
| C_ID |
C00035379
, 
|
| InChIKey |
CBVKMAVNTVJDHT-QPJJXVBHNA-N |
| InChICode |
InChI=1S/C35H46O20/c1-14-24(42)26(44)28(46)33(51-14)50-13-22-31(54-23(41)7-4-15-2-5-17(37)19(39)10-15)32(55-35-29(47)27(45)25(43)21(12-36)52-35)30(48)34(53-22)49-9-8-16-3-6-18(38)20(40)11-16/h2-7,10-11,14,21-22,24-40,42-48H,8-9,12-13H2,1H3/b7-4+/t14-,21-,22-,24-,25-,26+,27+,28-,29-,30-,31-,32-,33-,34-,35+/m0/s1 |
| SMILES |
CC1OC(OCC2OC(OCCc3ccc(O)c(O)c3)C(O)C(OC3OC(CO)C(O)C(O)C3O)C2OC(=O)/C=C/c2ccc(O)c(O)c2)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Digitalis purpurea  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
|
|
zoom in
| Organism | Rehmannia glutinosa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Shoyama, et al., Phytochemistry, 25, (1986), 1633.
Matsumoto, et al., Phytochemistry, 26, (1987), 3225 |
|---|
|