| Name |
Phyllanthusiin D |
| Formula |
C44H32O27 |
| Mw |
992.11309582 |
| CAS RN |
133145-19-4 |
| C_ID |
C00035368
, 
|
| InChIKey |
RLIDGKWTTDJVIN-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C44H32O27/c1-10(45)8-43(63)22(51)7-15-26-25-14(6-20(50)30(55)34(25)71-44(26,43)64)40(61)69-36-35-33(67-41(15)62)21(66-42(36)70-37(58)11-2-16(46)27(52)17(47)3-11)9-65-38(59)12-4-18(48)28(53)31(56)23(12)24-13(39(60)68-35)5-19(49)29(54)32(24)57/h2-7,21,26,33,35-36,42,46-50,52-57,63-64H,8-9H2,1H3/t21-,26-,33-,35-,36-,42+,43-,44+/m0/s1 |
| SMILES |
CC(=O)CC1(O)C(=O)C=C2C(=O)OC3C4COC(=O)c5cc(O)c(O)c(O)c5-c5c(cc(O)c(O)c5O)C(=O)OC3C(OC(=O)c3cc(O)c(O)c5c3C2C1(O)O5)C(OC(=O)c1cc(O)c(O)c(O)c1)O4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Geraniaceae | Geranium thunbergii | Ref. |
| - | - | Euphoria longan | Ref. |
|
|
zoom in
| Organism | Euphoria longan | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001) |
|---|
|