| Name |
Erinoside |
| Formula |
C16H20O11 |
| Mw |
388.10056148 |
| CAS RN |
862423-33-4 |
| C_ID |
C00035305
, 
|
| InChIKey |
KBSHFBMEJDATRW-MILPQAPWNA-N |
| InChICode |
InChI=1S/C16H20O11/c17-3-8-10(18)11(19)12(20)16(26-8)27-15-9-5(1-2-6(9)13(21)22)7(4-25-15)14(23)24/h4-5,8,10-12,15-20H,1-3H2,(H,21,22)(H,23,24)/t5-,8-,10+,11+,12-,15+,16+/m1/s1 |
| SMILES |
O=C(O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C2=C(C(=O)O)CC[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Erinus alpinus | Ref. |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
|
|
zoom in
| Organism | Veronica perfoliata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|