| Name |
Bangangxanthone A |
| Formula |
C23H22O6 |
| Mw |
394.14163844 |
| CAS RN |
869648-16-8 |
| C_ID |
C00035249
, 
|
| InChIKey |
HFJSQHGZXHTCLI-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C23H22O6/c1-12(2)5-4-9-23(3)10-8-13-17(29-23)11-16(26)19-20(27)18-14(24)6-7-15(25)22(18)28-21(13)19/h5-8,10-11,24-26H,4,9H2,1-3H3/t23-/m0/s1 |
| SMILES |
CC(C)=CCCC1(C)C=Cc2c(cc(O)c3c(=O)c4c(O)ccc(O)c4oc23)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia polyantha Oliv. | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia smeathmannii | Ref. |
|
|
zoom in
| Organism | Garcinia smeathmannii | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|