| Name |
6''-O-alpha-D-galactopyranosyl harpagoside Harprocumbide A (+)-Harprocumbide A |
| Formula |
C30H40O16 |
| Mw |
656.23163523 |
| CAS RN |
906563-60-8 |
| C_ID |
C00035109
, 
|
| InChIKey |
UWFOZHRIYIQCSM-TWHDJENSNA-N |
| InChICode |
InChI=1S/C30H40O16/c1-29(46-18(33)8-7-14-5-3-2-4-6-14)11-17(32)30(40)9-10-41-28(25(29)30)45-27-24(39)22(37)20(35)16(44-27)13-42-26-23(38)21(36)19(34)15(12-31)43-26/h2-10,15-17,19-28,31-32,34-40H,11-13H2,1H3/b8-7+/t15-,16-,17-,19+,20-,21+,22+,23-,24-,25-,26+,27+,28+,29+,30+/m1/s1 |
| SMILES |
C[C@]1(OC(=O)/C=C/c2ccccc2)C[C@@H](O)[C@]2(O)C=CO[C@@H](O[C@@H]3O[C@H](COC4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pedaliaceae | Harpagophytum prucumbens D.C. | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|