| Name |
8-Cinnamoylmyoporoside (-)-8-Cinnamoylmyoporoside Laterioside (-)-Laterioside |
| Formula |
C24H30O10 |
| Mw |
478.18389718 |
| CAS RN |
70206-27-8 |
| C_ID |
C00034975
, 
|
| InChIKey |
KVVGJHLYSWKDDI-DHKHOQTKNA-N |
| InChICode |
InChI=1S/C24H30O10/c1-24(34-17(27)8-7-13-5-3-2-4-6-13)11-15(26)14-9-10-31-22(18(14)24)33-23-21(30)20(29)19(28)16(12-25)32-23/h2-10,14-16,18-23,25-26,28-30H,11-12H2,1H3/b8-7+/t14-,15-,16-,18-,19-,20+,21-,22+,23+,24+/m1/s1 |
| SMILES |
C[C@]1(OC(=O)/C=C/c2ccccc2)CC(O)[C@@H]2C=CO[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pedaliaceae | Harpagophytum prucumbens D.C. | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia deserti  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lateriflora | Ref. |
|
|
zoom in
| Organism | Scrophularia dentata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|