| Name |
Buddlejoside A8 Lagotisoside D |
| Formula |
C32H42O17 |
| Mw |
698.24219992 |
| CAS RN |
140187-14-0 |
| C_ID |
C00034972
, 
|
| InChIKey |
FTSYZMGPOMMSIZ-SNOWFEKTNA-N |
| InChICode |
InChI=1S/C32H42O17/c1-13-26(46-19(35)7-5-14-4-6-16(41-2)17(10-14)42-3)23(38)25(40)30(44-13)47-27-15-8-9-43-29(20(15)32(12-34)28(27)49-32)48-31-24(39)22(37)21(36)18(11-33)45-31/h4-10,13,15,18,20-31,33-34,36-40H,11-12H2,1-3H3/b7-5+/t13-,15-,18+,20+,21-,22-,23-,24+,25+,26-,27-,28-,29-,30-,31-,32+/m0/s1 |
| SMILES |
COc1ccc(/C=C/C(=O)O[C@@H]2[C@@H](O)[C@@H](O)[C@H](O[C@H]3[C@@H]4C=CO[C@@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H]4[C@@]4(CO)O[C@@H]34)O[C@H]2C)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Buddlejaceae | Buddleja japonica Hemsl. | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia deserti  | Ref. |
|
|
zoom in
| Organism | Scrophularia dentata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|