| Name |
6-Deoxyisojacareubin |
| Formula |
C18H14O5 |
| Mw |
310.08412356 |
| CAS RN |
26486-92-0 |
| C_ID |
C00034926
, 
|
| InChIKey |
XWRLBJDPJRDNKF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O5/c1-18(2)7-6-9-13(23-18)8-12(20)14-15(21)10-4-3-5-11(19)16(10)22-17(9)14/h3-8,19-20H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(cc(O)c3c(=O)c4cccc(O)c4oc23)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae | Pentaphalangium solomonse Warb. | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia merguensis | Ref. |
| Plantae | Hypericaceae | Hypericum japonicum  | Ref. |
| Plantae | Hypericaceae | Vismia laurentii  | Ref. |
|
|
zoom in
| Organism | Garcinia bracteata | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|