| Name |
Wulignan A2 |
| Formula |
C20H22O5 |
| Mw |
342.14672381 |
| CAS RN |
117047-77-5 |
| C_ID |
C00034919
, 
|
| InChIKey |
WFNWOPFVZGRWFA-WXEYJKJQNA-N |
| InChICode |
InChI=1S/C20H22O5/c1-10-11(2)20(23)14-9-18(25-4)16(22)8-13(14)19(10)12-5-6-15(21)17(7-12)24-3/h5-11,19,21-22H,1-4H3/t10-,11-,19-/m1/s1 |
| SMILES |
COc1cc([C@@H]2c3cc(O)c(OC)cc3C(=O)[C@H](C)[C@H]2C)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Holostylis reniformis | Ref. |
| Plantae | Schisandraceae | Schisandra henryi | Ref. |
|
|
zoom in
| Organism | Schisandra henryi | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|