| Name |
Morusignin J |
| Formula |
C23H22O6 |
| Mw |
394.14163844 |
| CAS RN |
149733-93-7 |
| C_ID |
C00034875
, 
|
| InChIKey |
UTJUCKQNRWMQHF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H22O6/c1-11(2)5-6-12-18(26)17-19(27)16-14(24)7-8-15(25)22(16)28-21(17)13-9-10-23(3,4)29-20(12)13/h5,7-10,24-26H,6H2,1-4H3 |
| SMILES |
CC(C)=CCc1c2c(c3oc4c(O)ccc(O)c4c(=O)c3c1O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia propinqua | Ref. |
| Plantae | Moraceae | Morus insignis | Ref. |
|
|
zoom in
| Organism | Garcinia propinqua | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|