| Name |
Calceolarioside C |
| Formula |
C28H34O15 |
| Mw |
610.18977042 |
| CAS RN |
114217-04-8 |
| C_ID |
C00034810
, 
|
| InChIKey |
GNDDBOHLMOANGU-ZZXKWVIFNA-N |
| InChICode |
InChI=1S/C28H34O15/c29-15-4-1-13(9-17(15)31)3-6-21(34)43-26-20(12-41-27-24(37)22(35)19(33)11-40-27)42-28(25(38)23(26)36)39-8-7-14-2-5-16(30)18(32)10-14/h1-6,9-10,19-20,22-33,35-38H,7-8,11-12H2/b6-3+/t19-,20+,22-,23-,24-,25+,26+,27+,28-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)OC1C(COC2OCC(O)C(O)C2O)OC(OCCc2ccc(O)c(O)c2)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Nyctanthes arbor-tristis L.  | Ref. |
| Plantae | Plantaginaceae | Veronica anagallis-aquatica  | Ref. |
| Plantae | Scrophulariaceae | Ellisiophyllum pinnatum (Wall.ex.Benth.) | Ref. |
|
|
zoom in
| Organism | Veronica anagallis-aquatica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|