| Name |
Rumejaposide E
(-)-Rumejaposide E |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
957792-40-4 |
| C_ID |
C00034664
, 
|
| InChIKey |
MTRZNLNUNVGZPP-DHLYWHPBNA-N |
| InChICode |
InChI=1S/C21H22O10/c1-7-2-9-14(11(24)3-7)17(27)15-10(4-8(23)5-12(15)25)21(9,30)20-19(29)18(28)16(26)13(6-22)31-20/h2-5,13,16,18-20,22-26,28-30H,6H2,1H3/t13-,16+,18+,19-,20-,21-/m1/s1 |
| SMILES |
Cc1cc(O)c2c(c1)[C@](O)([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cc(O)cc(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Rumex japonicus  | Ref. |
| Plantae | Polygonaceae | Rumex patientia | Ref. |
|
|
zoom in
| Organism | Rumex patientia |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
