| Name |
Minutoside A (-)-Minutoside A |
| Formula |
C32H54O12S |
| Mw |
662.33359792 |
| CAS RN |
863919-17-9 |
| C_ID |
C00034605
, 
|
| InChIKey |
JJOMVGVJXRBILN-PYPVIVDQNA-N |
| InChICode |
InChI=1S/C32H54O12S/c1-16(2)24(43-29-27(37)26(36)23(35)15-42-29)7-6-17(3)19-13-21(33)28-31(19,5)11-9-25-30(4)10-8-18(44-45(39,40)41)12-20(30)22(34)14-32(25,28)38/h6-7,16-29,33-38H,8-15H2,1-5H3,(H,39,40,41)/b7-6+/t17-,18-,19+,20+,21+,22-,23-,24-,25+,26-,27-,28+,29+,30-,31+,32-/m0/s1 |
| SMILES |
CC(C)[C@H](/C=C/[C@@H](C)[C@H]1C[C@@H](O)[C@@H]2[C@]1(C)CC[C@@H]1[C@@]3(C)CC[C@H](OS(=O)(=O)O)C[C@@H]3[C@@H](O)C[C@]12O)O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Asteriidae | Lethasterias fusca | Ref. |
| Plantae | Alliaceae | Allium albopilosum | Ref. |
| Plantae | Alliaceae | Allium karataviense | Ref. |
| Plantae | Alliaceae | Allium minutiflorum | Ref. |
| Plantae | Alliaceae | Allium ostrowskianum | Ref. |
|
|
zoom in
| Organism | Allium albopilosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|