| Name |
Lycoclavanol (-)-Lycoclavanol |
| Formula |
C30H50O3 |
| Mw |
458.37599546 |
| CAS RN |
13956-51-9 |
| C_ID |
C00034037
, 
|
| InChIKey |
VYUNCIDAMBNEFU-IJRXDHRONA-N |
| InChICode |
InChI=1S/C30H50O3/c1-26(2)21-9-7-19-17-27(3)14-11-23-29(5,16-13-25(33)30(23,6)18-31)22(27)10-8-20(19)28(21,4)15-12-24(26)32/h7,20-25,31-33H,8-18H2,1-6H3/t20-,21-,22-,23+,24+,25+,27-,28+,29+,30+/m0/s1 |
| SMILES |
CC1(C)[C@H](O)CC[C@]2(C)[C@H]3CC[C@H]4[C@@](C)(CC[C@@H]5[C@]4(C)CC[C@@H](O)[C@]5(C)CO)CC3=CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Diphasiastrum complanatum L.Holub | Ref. |
| Plantae | Lycopodiaceae | Lycopodium japonicum | Ref. |
|
|
zoom in
| Organism | Lycopodium japonicum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|