| Name |
Lycoclavanin |
| Formula |
C30H48O5 |
| Mw |
488.35017464 |
| CAS RN |
27832-90-2 |
| C_ID |
C00034036
, 
|
| InChIKey |
RNXYWTBSHDUEBG-ICNYNOMONA-N |
| InChICode |
InChI=1S/C30H48O5/c1-26(2)24-19(32)13-17-14-27(3)11-9-22-28(4,12-10-23(34)30(22,6)16-31)21(27)8-7-18(17)29(24,5)15-20(33)25(26)35/h13,18,20-25,31,33-35H,7-12,14-16H2,1-6H3/t18-,20+,21-,22+,23+,24-,25+,27-,28+,29+,30+/m0/s1 |
| SMILES |
CC1(C)[C@H](O)[C@H](O)C[C@]2(C)[C@H]3CC[C@H]4[C@@](C)(CC[C@@H]5[C@]4(C)CC[C@@H](O)[C@]5(C)CO)CC3=CC(=O)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Diphasiastrum complanatum L.Holub | Ref. |
| Plantae | Lycopodiaceae | Lycopodium japonicum | Ref. |
|
|
zoom in
| Organism | Lycopodium japonicum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|