| Name |
Lycernuic acid A |
| Formula |
C30H48O4 |
| Mw |
472.35526002 |
| CAS RN |
53755-77-4 |
| C_ID |
C00034035
, 
|
| InChIKey |
RGIWJHUJDHZDIN-PCOMYLENNA-N |
| InChICode |
InChI=1S/C30H48O4/c1-26(2)20-9-7-18-17-27(3)14-11-22-29(5,16-13-24(32)30(22,6)25(33)34)21(27)10-8-19(18)28(20,4)15-12-23(26)31/h7,19-24,31-32H,8-17H2,1-6H3,(H,33,34)/t19-,20-,21-,22+,23+,24-,27-,28+,29+,30+/m0/s1 |
| SMILES |
CC1(C)[C@H](O)CC[C@]2(C)[C@H]3CC[C@H]4[C@@](C)(CC[C@@H]5[C@]4(C)CC[C@H](O)[C@]5(C)C(=O)O)CC3=CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Diphasiastrum complanatum L.Holub | Ref. |
| Plantae | Lycopodiaceae | Lycopodium cernuum  | Ref. |
|
|
zoom in
| Organism | Lycopodium cernuum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Zhang, et al., Journal of Natural Products, 65, (2002), 979 |
|---|
|