| Name |
Koaburaside |
| Formula |
C14H20O9 |
| Mw |
332.11073224 |
| CAS RN |
41653-73-0 |
| C_ID |
C00033999
, 
|
| InChIKey |
SWHCKWOYUSDWOF-PPTNFGOFNA-N |
| InChICode |
InChI=1S/C14H20O9/c1-20-7-3-6(4-8(21-2)10(7)16)22-14-13(19)12(18)11(17)9(5-15)23-14/h3-4,9,11-19H,5H2,1-2H3/t9-,11+,12+,13-,14-/m1/s1 |
| SMILES |
COc1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Capparaceae | Capparis flavicans | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Rubiaceae | Canthium berberidifolium | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
|
|
zoom in
| Organism | Eucommia ulmoides | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|