| Name |
Isojacareubin |
| Formula |
C18H14O6 |
| Mw |
326.07903818 |
| CAS RN |
50597-93-8 |
| C_ID |
C00033957
, 
|
| InChIKey |
FSTNFJKGRSHPBO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O6/c1-18(2)6-5-8-12(24-18)7-11(20)13-14(21)9-3-4-10(19)15(22)17(9)23-16(8)13/h3-7,19-20,22H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(cc(O)c3c(=O)c4ccc(O)c(O)c4oc23)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia cowa  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia fusca | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xipshuanbannaensis | Ref. |
| Plantae | Hypericaceae | Hypericum roeperanum  | Ref. |
| - | - | Garcina xipshuanbannaensis | Ref. |
|
|
zoom in
| Organism | Garcinia fusca | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|