| Name |
Guaiacylglycerol-beta-ferulic acid ether |
| Formula |
C20H22O8 |
| Mw |
390.13146768 |
| CAS RN |
639017-74-6 |
| C_ID |
C00033897
, 
|
| InChIKey |
VRPSNHRJPVYMJT-XBXARRHUNA-N |
| InChICode |
InChI=1S/C20H22O8/c1-26-16-10-13(5-6-14(16)22)20(25)18(11-21)28-15-7-3-12(4-8-19(23)24)9-17(15)27-2/h3-10,18,20-22,25H,11H2,1-2H3,(H,23,24)/b8-4+/t18-,20+/m0/s1 |
| SMILES |
COc1cc(C(O)C(CO)Oc2ccc(/C=C/C(=O)O)cc2OC)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Solanaceae | Solanum nigrum  | Ref. |
|
|
zoom in
| Organism | Solanum nigrum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|