| Name |
3,5-Caffeoyl quinic acid (-)-3,5-Dicaffeoyl quinic acid 3,5-di-O-Caffeoylquinic acid |
| Formula |
C25H24O12 |
| Mw |
516.12677623 |
| CAS RN |
89919-62-0 |
| C_ID |
C00033559
, 
|
| InChIKey |
KRZBCHWVBQOTNZ-RYUYRGTRNA-N |
| InChICode |
InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(30)36-19-11-25(35,24(33)34)12-20(23(19)32)37-22(31)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-29,32,35H,11-12H2,(H,33,34)/b7-3+,8-4+/t19-,20-,23-,25+/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Dothideomycetes | Alternaria alternata | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Scorzonera pseudodivaricata | Ref. |
| Plantae | Longaniaceae | Strychnos axillaris | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Artemisia annua | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|