| Name |
3,3'-Biplumbagin |
| Formula |
C22H14O6 |
| Mw |
374.07903818 |
| CAS RN |
34341-27-0 |
| C_ID |
C00032634
, 
|
| InChIKey |
WZPJBVWIDHOZAY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H14O6/c1-9-15(21(27)17-11(19(9)25)5-3-7-13(17)23)16-10(2)20(26)12-6-4-8-14(24)18(12)22(16)28/h3-8,23-24H,1-2H3 |
| SMILES |
CC1=C(C2=C(C)C(=O)c3cccc(O)c3C2=O)C(=O)c2c(O)cccc2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ebenaceae | Diospyros maritima BLUME  | Ref. |
| Plantae | Plumbaginaceae | Plumbago indica | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
|
|
zoom in
| Organism | Plumbago indica |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
