| Name |
1,3,5-Trihydroxy-4-prenylxanthone |
| Formula |
C18H16O5 |
| Mw |
312.09977362 |
| CAS RN |
53377-61-0 |
| C_ID |
C00032581
, 
|
| InChIKey |
JCHQJCJKSHNCBA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O5/c1-9(2)6-7-10-13(20)8-14(21)15-16(22)11-4-3-5-12(19)17(11)23-18(10)15/h3-6,8,19-21H,7H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c(=O)c3cccc(O)c3oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia amplexicaulis | Ref. |
|
|
zoom in
| Organism | Garcinia amplexicaulis | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|