| Name |
1,2,3,6-Tetra-O-galloyl-beta-D-glucose 1,2,3,6-tetra-O-Galloyl-beta-D-glucose |
| Formula |
C34H38O22 |
| Mw |
798.1854729 |
| CAS RN |
79886-50-3 |
| C_ID |
C00032577
, 
|
| InChIKey |
RATQVALKDAUZBW-JYJSKMCINA-N |
| InChICode |
InChI=1S/C34H28O22/c35-14-1-10(2-15(36)23(14)43)30(48)52-9-22-27(47)28(54-31(49)11-3-16(37)24(44)17(38)4-11)29(55-32(50)12-5-18(39)25(45)19(40)6-12)34(53-22)56-33(51)13-7-20(41)26(46)21(42)8-13/h1-8,22,27-29,34-47H,9H2/t22-,27-,28+,29-,34+/m1/s1 |
| SMILES |
O=C(OC[C@H]1O[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H]1O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chenopodiaceae | Cornulaca monacantha  | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
| Plantae | Paeoniaceae | Paeonia lactiflora wild.  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|