| Name |
Zaluzanin D |
| Formula |
C17H20O4 |
| Mw |
288.13615913 |
| CAS RN |
16838-85-0 |
| C_ID |
C00032545
, 
|
| InChIKey |
GKMFOEIZCLMZDE-OQJGQLIJNA-N |
| InChICode |
InChI=1S/C17H20O4/c1-8-5-6-12-9(2)17(19)21-16(12)15-10(3)14(7-13(8)15)20-11(4)18/h12-16H,1-3,5-7H2,4H3/t12-,13-,14-,15-,16-/m0/s1 |
| SMILES |
C=C1[C@@H]2[C@H]3OC(=O)C(=C)[C@@H]3CCC(=C)[C@@H]2C[C@@H]1OC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Zaluzania angusta | Ref. |
| Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
| Plantae | Lauraceae | Laurus nobilis L.  | Ref. |
|
|
zoom in
| Organism | Conocephalum conicum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
UCHIYAMA, et al., Chem Pharm Bull, 50, (2002), 1514 |
|---|
|