| Name |
1,3-Dihydroxyanthraquinone Xanthopurpurin |
| Formula |
C14H8O4 |
| Mw |
240.04225874 |
| CAS RN |
518-83-2 |
| C_ID |
C00032518
, 
|
| InChIKey |
WPWWKBNOXTZDQJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16H |
| SMILES |
O=C1c2ccccc2C(=O)c2c(O)cc(O)cc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Asperula odorata  | Ref. |
| Plantae | Rubiaceae | Rubia tinctorum  | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
| Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
|
|
zoom in
| Organism | Rubia tinctorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|