| Name |
Strophanthidin Strophanthidin K Strophanthidine |
| Formula |
C23H32O6 |
| Mw |
404.21988875 |
| CAS RN |
66-28-4 |
| C_ID |
C00032213
, 
|
| InChIKey |
ODJLBQGVINUMMR-RPMQJOTQNA-N |
| InChICode |
InChI=1S/C23H32O6/c1-20-6-3-17-18(4-8-22(27)11-15(25)2-7-21(17,22)13-24)23(20,28)9-5-16(20)14-10-19(26)29-12-14/h10,13,15-18,25,27-28H,2-9,11-12H2,1H3/t15-,16+,17-,18+,20+,21-,22-,23-/m0/s1 |
| SMILES |
C[C@]12CC[C@H]3[C@@H](CC[C@]4(O)C[C@@H](O)CC[C@]34C=O)[C@@]1(O)CC[C@@H]2C1=CC(=O)OC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Apocynum venetum  | Ref. |
| Plantae | Apocynaceae | Periploca nigrescens | Ref. |
| Plantae | Apocynaceae | Strophanthus kombe  | Ref. |
| Plantae | Convallariaceae | Convallaria majalis L.  | Ref. |
| Plantae | Crossosomataceae | Crossosoma bigelovii | Ref. |
| Plantae | Cruciferae | Descurainia sophia  | Ref. |
| Plantae | Cruciferae | Erysimum cheiranthoides | Ref. |
| Plantae | Moraceae | Antiaris toxicaria LESCH.  | Ref. |
| Plantae | Ranunculaceae | Adonis amurensis  | Ref. |
| Plantae | Ranunculaceae | Adonis tienschanicus | Ref. |
|
|
zoom in
| Organism | Periploca nigrescens | | Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Zhang, et al., NPRD, 15, (2003), 157.
Sun, et al., Chem Pharm Bull, 52, (2004), 1483 |
|---|
|