| Name |
Stachyurin |
| Formula |
C41H28O26 |
| Mw |
936.08688107 |
| CAS RN |
81739-27-7 |
| C_ID |
C00032196
, 
|
| InChIKey |
MMQXBTULXAEKQE-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C41H28O26/c42-11-1-7(2-12(43)23(11)47)37(58)64-16-6-63-38(59)8-3-13(44)24(48)27(51)17(8)18-9(4-14(45)25(49)28(18)52)39(60)65-34(16)36-35-32(56)22-21(41(62)66-35)20(30(54)33(57)31(22)55)19-10(40(61)67-36)5-15(46)26(50)29(19)53/h1-5,16,32,34-36,42-57H,6H2/t16-,32-,34+,35+,36+/m1/s1 |
| SMILES |
O=C(OC1COC(=O)c2cc(O)c(O)c(O)c2-c2c(cc(O)c(O)c2O)C(=O)OC1C1OC(=O)c2cc(O)c(O)c(O)c2-c2c(O)c(O)c(O)c3c2C(=O)OC1C3O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Casuarinaceae | Casuarina sticta | Ref. |
| Plantae | Fagaceae | Castanea mollissima  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Melastomataceae | Tibouchina multiflora | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Rosa roxburghii  | Ref. |
| Plantae | Stachyuraceae | Stachyurus praecox Sieb.et Zucc. | Ref. |
|
|
zoom in
| Organism | Castanea mollissima | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|