| Name |
(3beta,5alpha)-Stigmastan-3-ol Sitostanol beta-Sitostanol Stigmastanol |
| Formula |
C29H52O |
| Mw |
416.40181628 |
| CAS RN |
83-45-4 |
| C_ID |
C00032163
, 
|
| InChIKey |
LGJMUZUPVCAVPU-MOSOHJMJNA-N |
| InChICode |
InChI=1S/C29H52O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h19-27,30H,7-18H2,1-6H3/t20-,21-,22+,23+,24-,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calendula officinalis  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Calycanthaceae | Calycanthus floridus | Ref. |
| Plantae | Combretaceae | Pteleopsis hylodendron | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
| Plantae | Cyatheaceae | Cyathea podophylla | Ref. |
| Plantae | Lauraceae | Litsea japonica | Ref. |
| Plantae | Lauraceae | Neolitsea aciculata | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Piperaceae | Piper nigrum L.  | Ref. |
| Plantae | Poaceae | Hordeum vulgare L.cv Mammut  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Rubiaceae | Coffea charrieriana | Ref. |
| Plantae | Rubiaceae | Coffea congensis | Ref. |
| Plantae | Rubiaceae | Coffea eugenioides  | Ref. |
| Plantae | Rubiaceae | Coffea hetero calyx | Ref. |
| Plantae | Rubiaceae | Coffea humblotiana | Ref. |
| Plantae | Rubiaceae | Coffea humilis | Ref. |
| Plantae | Rubiaceae | Coffea kapakata | Ref. |
| Plantae | Rubiaceae | Coffea liberica var.dewevrei  | Ref. |
| Plantae | Rubiaceae | Coffea liberica var.liberica  | Ref. |
| Plantae | Rubiaceae | Coffea pseudozanguebariae | Ref. |
| Plantae | Rubiaceae | Coffea racemosa | Ref. |
| Plantae | Rubiaceae | Coffea salvatrix | Ref. |
| Plantae | Rubiaceae | Coffea sessiliflora | Ref. |
| Plantae | Rubiaceae | Coffea stenophylla | Ref. |
| Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Chattonella marina | Ref. |
|
|
zoom in
| Organism | Rhaponticum carthamoides | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., NPRD, 11, (1999), 4 |
|---|
|