| Name |
Myrrhanol B |
| Formula |
C30H50O4 |
| Mw |
474.37091008 |
| CAS RN |
446030-41-7 |
| C_ID |
C00032050
, 
|
| InChIKey |
XKZRMBOWVKGAPH-SGGUKNPKNA-N |
| InChICode |
InChI=1S/C30H50O4/c1-21(13-9-15-23(3)27(32)33)11-8-12-22(2)14-10-16-25-29(6)19-18-26(31)28(4,5)24(29)17-20-30(25,7)34/h11,14-15,24-26,31,34H,8-10,12-13,16-20H2,1-7H3,(H,32,33)/b21-11+,22-14+,23-15+/t24-,25+,26-,29+,30+/m0/s1 |
| SMILES |
C/C(=CCC/C(C)=C/CC[C@@H]1[C@@]2(C)CC[C@H](O)C(C)(C)[C@@H]2CC[C@@]1(C)O)CC/C=C(C)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Burseraceae | Balsamodendron mukul HOOK.  | Ref. |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
|
|
zoom in
| Organism | Commiphora mukul | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|