| Name |
Morenone 1 |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
144828-18-2 |
| C_ID |
C00032029
, 
|
| InChIKey |
GIRIDEAJDHKWPT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O5/c1-8-4-10-11(7-13(8)18)16(19)12-5-9(21-2)6-14(22-3)15(12)17(10)20/h4-7,18H,1-3H3 |
| SMILES |
COc1cc(OC)c2c(c1)C(=O)c1cc(O)c(C)cc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia L  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
|
|
zoom in
| Organism | Morinda officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|