| Name |
Isohyperoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
35589-21-0 |
| C_ID |
C00031906
, 
|
| InChIKey |
OPJZLUXFQFQYAI-FLJDNWQENA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-12(27)19-16(29)17(30)21(32-19)33-20-15(28)14-11(26)4-8(23)5-13(14)31-18(20)7-1-2-9(24)10(25)3-7/h1-5,12,16-17,19,21-27,29-30H,6H2/t12-,16+,17-,19+,21+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@@H]([C@H](O)CO)[C@H](O)[C@H]2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Alnus japonica  | Ref. |
| Plantae | Ericaceae | Rhododendron dauricum  | Ref. |
|
|
zoom in
| Organism | Rhododendron dauricum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|