| Name |
1-Hydroxy-2-methyl-9,10-anthraquinone 1-Hydroxy-2-methylanthraquinone |
| Formula |
C15H10O3 |
| Mw |
238.06299419 |
| CAS RN |
6268-09-3 |
| C_ID |
C00031526
, 
|
| InChIKey |
CZODYZFOLUNSFR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O3/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7,16H,1H3 |
| SMILES |
Cc1ccc2c(c1O)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
| Plantae | Rubiaceae | Prismatomeris tetrandra | Ref. |
| Plantae | Rubiaceae | Rubia tinctorum  | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
| Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
| - | - | Proclema pendula | Ref. |
|
|
zoom in
| Organism | Morinda officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|