| Name |
(+)-Diayangambin |
| Formula |
C24H30O8 |
| Mw |
446.19406794 |
| CAS RN |
21453-68-9 |
| C_ID |
C00031455
, 
|
| InChIKey |
HRLFUIXSXUASEX-UEDZPFAQNA-N |
| InChICode |
InChI=1S/C24H30O8/c1-25-17-7-13(8-18(26-2)23(17)29-5)21-15-11-32-22(16(15)12-31-21)14-9-19(27-3)24(30-6)20(10-14)28-4/h7-10,15-16,21-22H,11-12H2,1-6H3/t15-,16-,21-,22-/m0/s1 |
| SMILES |
COc1cc([C@@H]2OC[C@H]3[C@@H]2CO[C@H]3c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Burseraceae | Balsamodendron mukul HOOK.  | Ref. |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
|
|
zoom in
| Organism | Commiphora mukul | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|