| Name |
Montbretol 6,12-Dihydroxyabieta-5,8,11,13-tetraen-7-one |
| Formula |
C20H26O3 |
| Mw |
314.1881947 |
| CAS RN |
140923-35-9 |
| C_ID |
C00030792
, 
|
| InChIKey |
XLUHSPYVUOVWRM-GNLPSFAGNA-N |
| InChICode |
InChI=1S/C20H26O3/c1-11(2)12-9-13-14(10-15(12)21)20(5)8-6-7-19(3,4)18(20)17(23)16(13)22/h9-11,21,23H,6-8H2,1-5H3/t20-/m1/s1 |
| SMILES |
CC(C)c1cc2c(cc1O)[C@@]1(C)CCCC(C)(C)C1=C(O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Cladoniaceae | Cladonia rangiferina  | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia | Ref. |
| Plantae | Cupressaceae | Juniperus formosana Hay.var.concolor Hay | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
|
|
zoom in
| Organism | Cephalotaxus harringtonia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|