| Name |
Ethyl caffeate Ethyl 3,4-dihydroxy cinnamate |
| Formula |
C11H12O4 |
| Mw |
208.07355887 |
| CAS RN |
102-37-4 |
| C_ID |
C00030221
, 
|
| InChIKey |
WDKYDMULARNCIS-GQCTYLIASA-N |
| InChICode |
InChI=1S/C11H12O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3-7,12-13H,2H2,1H3/b6-4+ |
| SMILES |
CCOC(=O)/C=C/c1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Rosaceae | Prunus yedoensis | Ref. |
| Plantae | Smilacaceae | Smilax china  | Ref. |
| - | - | Robdosia coetsa | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|